Animated Solution for Chemistry - Organic Chemistry: Which of the following reaction is an example of ammonolysis?
Select Answer:
Visualized Solution
Decoding Ammonolysis
Ammonolysis is the process of cleavage of the C−X bond by an ammonia (NH3) molecule.
Option A: Acylation
C6H5COCl+C6H5NH2→C6H5CONHC6H5
This is an acylation reaction (Schotten-Baumann reaction), not ammonolysis.
Option B: Reduction
C6H5CH2CN[H]C6H5CH2CH2NH2
This is the reduction of a nitrile to a primary amine.
Option C: Acid-Base Reaction
C6H5NH2HClC6H5N+H3Cl−
This is a simple acid-base neutralization forming a salt.
Option D: The Ammonolysis
C6H5CH2Cl+NH3→C6H5CH2NH2
Benzyl chloride reacts with ammonia. The C−Cl bond is cleaved by NH3.
Nucleophilic Substitution (SN2)
The lone pair on nitrogen attacks the electrophilic carbon, displacing the chloride ion.
Formation of Primary Amine
The intermediate loses a proton to form Benzylamine (C6H5CH2NH2).
00:00 / 00:00
The Sigma Insight: Haloalkanes & Haloarenes
Solution Diagram
Decoding the Term
Ammonolysis
When you encounter a term like ammonolysis in organic chemistry, the best approach is to break it down into its roots. The word is a combination of "ammono," referring to the ammonia molecule (NH3), and "lysis," which means cleavage or breaking.
Therefore, ammonolysis is a reaction where an ammonia molecule acts as a nucleophile to cleave a specific bond—most commonly, a carbon-halogen (C−X) bond in an alkyl or benzyl halide.
Analyzing the Options
Let's evaluate each given reaction to see which one fits our definition perfectly.
Option A: Acylation
C6H5COCl+C6H5NH2→C6H5CONHC6H5
In this reaction, benzoyl chloride reacts with aniline. The amine acts as a nucleophile, attacking the carbonyl carbon and displacing the chloride ion. This is a classic acylation reaction (specifically, the Schotten-Baumann reaction). Since ammonia is not involved, this is not ammonolysis.
Option B: Reduction
C6H5CH2CN[H]C6H5CH2CH2NH2
Here, benzyl cyanide is treated with a reducing agent to form 2-phenylethanamine. This is a straightforward reduction of a nitrile group to a primary amine. No bonds are being cleaved by ammonia.
Option C: Acid-Base Neutralization
C6H5NH2HClC6H5N+H3Cl−
Aniline is a base, and hydrochloric acid is an acid. When they react, they undergo a simple acid-base neutralization to form anilinium chloride, a salt. There is no cleavage of a carbon-halogen bond here.
The Master Equation
Ammonolysis in Action
Option D: The Correct Answer
C6H5CH2Cl+NH3→C6H5CH2NH2
This reaction features benzyl chloride reacting with ammonia. Let's dive into the mechanism to see exactly why this is our winner.
The nitrogen atom in the ammonia molecule possesses a lone pair of electrons, making it an excellent nucleophile. It seeks out the slightly positive (electrophilic) benzylic carbon atom.
As the ammonia molecule attacks the benzylic carbon, the carbon-chlorine bond begins to break simultaneously. This is a classic SN2 (Substitution Nucleophilic Bimolecular) mechanism. The chloride ion (Cl−) acts as the leaving group.
The initial attack forms a protonated amine intermediate (C6H5CH2N+H3). To regain neutrality, this intermediate quickly loses a proton to another ammonia molecule (or the chloride ion), yielding the final product: benzylamine (C6H5CH2NH2).
Because the ammonia molecule was directly responsible for the cleavage of the carbon-halogen bond, this reaction is the perfect textbook example of ammonolysis.