Animated Solution for Mathematics - Trigonometry: A spherical gas balloon of radius 16 meter subtends an angle 60∘ at the eye of the observer A while the angle of elevation of its center from the eye of A is 75∘. Then the height (in meter) of the top most point of the balloon from the level of the observer's eye is:
Select Answer:
Visualized Solution
Visualizing the Setup
Let A be the observer's eye level.
Let O be the center of the spherical balloon.
Radius of the balloon, r=16 m.
Symmetry and Half Angle
The balloon subtends an angle of 60∘ at eye A.
This is the angle between the two tangents from A to the sphere.
By symmetry, the line AO bisects this angle.
Therefore, the half-angle ∠OAP=260∘=30∘.
Distance to Center OA
In right-angled triangle OAP:
sin(30∘)=OAOP
Substitute OP=16 m.
Calculating OA
21=OA16
OA=32 m
Angle of Elevation of Center
The angle of elevation of the center O from eye A is 75∘.
Let R be the point on the horizontal eye level directly below O.
In △ARO, ∠OAR=75∘.
Height of Center OR
In △ARO:
sin(75∘)=OAOR
OR=OAsin(75∘)
OR=32sin(75∘)
Calculating sin(75∘)
Using sin(A+B)=sinAcosB+cosAsinB:
sin(75∘)=sin(45∘+30∘)
sin(75∘)=sin45∘cos30∘+cos45∘sin30∘
sin(75∘)=21⋅23+21⋅21
sin(75∘)=223+1
Evaluating OR
OR=32⋅223+1
OR=216(3+1)
OR=82(3+1)
OR=86+82
Height of the Topmost Point
The top most point T is at a distance r vertically above the center O.
Total height H=OR+r
H=(86+82)+16
Final Simplification
H=86+82+16
Factoring out 8:
H=8(6+2+2) m
This matches Option 2.
00:00 / 00:00
The Sigma Insight: Heights and Distances
Solution Diagram
The Geometry of Sight
Unveiling the Balloon
Imagine you are standing on a vast, open field. You look up and see a massive spherical balloon floating in the sky. As a student of physics, your mind immediately begins to map the geometry of the scene, transforming a serene moment into a problem of trigonometry and spatial reasoning.
Phase 1
The Symmetry of Tangents
When you look at a sphere from a point A, your lines of sight are essentially tangents to that sphere. The problem states the balloon subtends an angle of 60∘ at your eye. If we draw a line from your eye A to the center of the balloon O, this line acts as an axis of symmetry, bisecting the 60∘ angle into two 30∘ angles.
Consider the right-angled triangle formed by your eye A, the center O, and a point of tangency P. Because the radius OP is perpendicular to the tangent AP, we have a right triangle △OAP. With the half-angle ∠OAP=30∘ and the radius OP=16 m, we find the distance to the center using the sine ratio:
sin(30∘)=OAOP
Since sin(30∘)=21, we find that OA=32 m. You have successfully calculated the distance to the heart of the balloon.
Phase 2
The Elevation of the Center
Next, we account for the angle of elevation. The center of the balloon O is at an angle of 75∘ above your horizontal eye level. Let R be the point on your horizontal level directly beneath the center O. We now have a new right triangle △ARO, where the hypotenuse is the distance OA=32 m.
The vertical height of the center, OR, is given by:
OR=OAsin(75∘)
To solve this, we use the compound angle identity sin(A+B)=sinAcosB+cosAsinB to expand sin(75∘) as sin(45∘+30∘):
We have the height of the center, but the question asks for the height of the topmost point of the balloon. Since the balloon is a sphere of radius r=16 m, the top point T sits exactly 16 m above the center O. Therefore, the total height H is:
H=OR+r=(86+82)+16
By factoring out the 8, we arrive at the elegant final form:
H=8(6+2+2)
This result is the culmination of understanding symmetry, trigonometric identities, and spatial visualization. By maintaining this clarity of thought, you ensure that no complex geometry problem will stand in your way.