LEVELJEE Main
Visualized Solution
The Sigma Insight: Haloalkanes & Haloarenes
The Setup
Analyzing the Reactant
Imagine you are looking at a microscopic battlefield. Our primary combatant is a molecule named trans-2-phenyl-1-bromocyclopentane.
Let's break down its structure. We have a five-membered carbon ring, a cyclopentane. Attached to this ring are two significant groups: a bromine atom at position 1, and a phenyl ring at position 2.
The word "trans" is the most critical piece of information here. It tells us about the 3D spatial arrangement of these groups. If we imagine the cyclopentane ring lying flat on a table, the bromine atom might be pointing "up" towards the ceiling (represented by a solid wedge), while the phenyl group is pointing "down" towards the floor (represented by a dashed line).
Because carbon atoms in a ring are tetrahedral, each carbon also has hydrogen atoms attached. At carbon-2, since the phenyl group is pointing down, the hydrogen atom must be pointing up. At carbon-1, since the bromine is pointing up, the hydrogen atom must be pointing down.
The Reagent
Alcoholic KOH
Now, we introduce our reagent: alcoholic KOH.
When potassium hydroxide is dissolved in an alcohol like ethanol, it forms alkoxide ions. These are incredibly strong bases. In the world of organic chemistry, when a strong base encounters a secondary alkyl halide like our reactant, it has one primary goal: Elimination.
Specifically, it triggers an elimination mechanism. The "E" stands for elimination, and the "2" stands for bimolecular, meaning the rate of the reaction depends on both the concentration of the base and the alkyl halide.
But the mechanism is not just a random tearing apart of the molecule. It is a highly choreographed, concerted dance of electrons that requires a very specific geometric alignment.
The Golden Rule of E2
Anti-Periplanar Geometry
For an elimination to occur, the departing hydrogen atom (the -hydrogen) and the leaving group (the bromine atom) must be anti-periplanar.
What does this mean? Imagine looking down the carbon-carbon bond. The hydrogen atom and the bromine atom must be pointing in exactly opposite directions, separated by a dihedral angle of .
Think of it like a perfectly aligned billiards shot. The base strikes the hydrogen from one side, and the force transfers straight through the carbon-carbon bond to eject the bromine out the exact opposite side. If they are not perfectly aligned, the reaction simply cannot happen.
Hunting for the Right Hydrogen
Our bromine is attached to carbon-1. To form a double bond, the base must steal a hydrogen from an adjacent carbon, known as a -carbon. We have two choices: carbon-2 and carbon-5. Let's investigate both.
First, let's look at carbon-2. We established earlier that because the molecule is "trans", the phenyl group is down, which means the hydrogen on carbon-2 is pointing up.
But wait! Our bromine atom on carbon-1 is also pointing up. This means the hydrogen on carbon-2 and the bromine on carbon-1 are cis to each other. Their dihedral angle is roughly . Because they are on the same side of the ring, they cannot achieve the required anti-periplanar geometry. Therefore, elimination cannot occur between carbon-1 and carbon-2.
Now, let's turn our attention to carbon-5. This carbon has two hydrogen atoms attached to it. One is pointing up (wedge), and the other is pointing down (dash).
Since our bromine atom is pointing up, we need a hydrogen that is pointing down. And bingo! Carbon-5 has exactly what we need. The dashed hydrogen on carbon-5 is perfectly anti-periplanar to the wedged bromine on carbon-1. This is our target!
The Mechanism in Action
Now, visualize the concerted mechanism unfolding.
The strong base, the hydroxide or alkoxide ion, approaches the molecule from the bottom face, targeting that specific dashed hydrogen on carbon-5.
As the base grabs the hydrogen, the electrons that formed the carbon-hydrogen bond are left behind. These electrons immediately swing inward, collapsing into the space between carbon-1 and carbon-5 to form a new -bond (a double bond).
Simultaneously, the electron density from the forming double bond pushes against the carbon-bromine bond. The bromine atom, being a good leaving group, takes its electrons and departs as a bromide ion () from the top face of the molecule.
Everything happens in one smooth, continuous motion.
The Final Product and a Classic Typo
The dust settles, and we are left with a new molecule. We have successfully formed a double bond between carbon-1 and carbon-5. The phenyl group remains untouched at its original position.
Now, we must name this new product according to IUPAC rules. We have a cyclopentene ring with a phenyl substituent.
The rules state that the carbons of the double bond must be numbered 1 and 2. We must also number around the ring in a direction that gives the substituent the lowest possible number.
If we assign the double bond carbons as 1 and 2, the carbon holding the phenyl group becomes carbon-3. Therefore, the correct IUPAC name for our product is 3-phenylcyclopentene.
A Word of Caution: If you look at the answer key provided in the original text, it claims the answer is option (b), which is 2-phenylcyclopentene. This is a classic typo!
As we have rigorously proven using the fundamental laws of stereochemistry, the double bond cannot form towards the phenyl-bearing carbon due to the lack of an anti-periplanar hydrogen. The reaction must proceed towards carbon-5, yielding 3-phenylcyclopentene. Even the reference solution's own diagram correctly draws and labels the product as 3-phenylcyclopentene!
Always trust the mechanism and the geometry over a printed answer key. The correct answer is undoubtedly option (d).
Similar Questions
JEE Main 2017
LEVELJEE Main
3-methyl-pent-2-ene on reaction with HBr in presence of peroxide forms an addition product. The number of possible stereoisomers for the product is
(A)
six
(B)
zero
(C)
two
(D)
four
LEVELJEE Main
2-methyl butane on reacting with bromine in the presence of sunlight gives mainly
(A)
1-bromo-3-methylbutane
(B)
2-bromo-3-methylbutane
(C)
2-bromo-2-methylbutane
(D)
1-bromo-2-methylbutane
JEE Main 2016
LEVELJEE Main
2-chloro-2-methylpentane on reaction with sodium methoxide in methanol yields I. II. III.
(A)
Both I and III
(B)
Only III
(C)
Both I and II
(D)
All of the above
JEE Main 2019
LEVELJEE Advanced
The major product in the following conversion is
(A)
CH3O-C6H4-CH(Br)-CH2-CH3
(B)
HO-C6H4-CH2-CH(Br)-CH3
(C)
CH3O-C6H4-CH2-CH(Br)-CH3
(D)
HO-C6H4-CH(Br)-CH2-CH3
JEE Main 2019
LEVELJEE Advanced
Heating of 2-chloro-1-phenyl butane with EtOK/EtOH gives as the major product. Reaction of with followed by gives as the major product. is
(A)
(B)
(C)
(D)
JEE Main 2020
LEVELJEE Advanced
In the following reaction sequence, [C] is
(A)
Cl-C6H4-CH2-CH2-C6H4-Cl
(B)
CH3-C6H4-C6H4-CH3
(C)
Cl-C6H4-CH2-C6H4-CH2-Cl
(D)
CH2(Cl)-C6H4-C6H4-CH2(Cl)
JEE Advanced 2016
LEVELJEE Advanced
In the following monobromination reaction, the number of possible chiral products is
LEVELJEE Main
HBr reacts with under anhydrous conditions at room temperature to give
(A)
and
(B)
and
(C)
(D)
JEE Main 2019
LEVELJEE Advanced
The compounds A and B in the following reaction are, respectively
(A)
A = Benzyl alcohol, B = Benzyl isocyanide
(B)
A = Benzyl alcohol, B = Benzyl cyanide
(C)
A = Benzyl chloride, B = Benzyl isocyanide
(D)
A = Benzyl chloride, B = Benzyl cyanide
JEE Main 2020
LEVELJEE Advanced
Which of the following reactions will not produce a racemic product?
(A)
4-methylcyclohexene +
(B)
(C)
(D)
