Animated Solution for Chemistry - Organic Chemistry: The major product of the following reaction is
Select Answer:
Visualized Solution
\text{Vicinal Dihalide}
Reactant: CH3CH2CH(Br)CH2Br
\text{First Dehydrohalogenation}
Reagent 1: Alcoholic KOH
Action: Removes one equivalent of HBr
\text{Formation of Vinyl Halide}
CH3CH2CH(Br)CH2BrAlc. KOHCH3CH2C(Br)=CH2
\text{The Resonance Trap}
Vinyl halides are unreactive towards Alc. KOH due to resonance.
\text{Second Dehydrohalogenation}
Reagent 2: NaNH2 in liq. NH3
Action: Removes second HBr to form Alkyne
\text{Acidic Terminal Alkyne}
CH3CH2C≡CH+NaNH2→CH3CH2C≡C−Na+
\text{Final Workup}
CH3CH2C≡C−Na+H+CH3CH2C≡CH
\text{The Way Forward}
What if aqueous KOH was used instead of alcoholic KOH?
00:00 / 00:00
The Sigma Insight: Hydrocarbons
Solution Diagram
Analyzing the Setup
Imagine you are looking at a molecule of 1,2-dibromobutane. This is a classic example of a vicinal dihalide, where two halogen atoms are attached to adjacent carbon atoms.
Our goal is to transform this saturated molecule into an alkyne. To do this, we need to perform a double dehydrohalogenation—essentially ripping away two molecules of hydrogen bromide (HBr). The reagents provided are alcoholic KOH followed by NaNH2 in liquid ammonia. Let's break down why this specific sequence is necessary.
The First Elimination
Alcoholic KOH
Alcoholic KOH is a strong base, perfectly suited for our first step. When it attacks the vicinal dihalide, it initiates an E2 elimination reaction. It abstracts a proton from one carbon while the bromine atom leaves from the adjacent carbon.
CH3CH2CH(Br)CH2BrAlc.KOHCH3CH2C(Br)=CH2
This single elimination yields an intermediate known as a vinyl halide (specifically, 2-bromo-1-butene).
The Resonance Trap
Now, you might wonder, why can't we just use more alcoholic KOH to remove the second HBr molecule? Here is the catch: vinyl halides are notoriously unreactive towards normal bases.
The lone pair of electrons on the bromine atom is in resonance with the newly formed carbon-carbon double bond. This delocalization gives the carbon-bromine bond a partial double bond character, making it significantly stronger and much harder to break. Alcoholic KOH simply isn't powerful enough to force the second elimination.
The Master Equation
Enter Sodamide
To overcome this resonance stabilization, we must bring in the heavy artillery: Sodamide (NaNH2) in liquid ammonia. Sodamide is an exceptionally strong base, far stronger than alcoholic KOH.
CH3CH2C(Br)=CH2NaNH2CH3CH2C≡CH
It forcefully abstracts the second proton, driving the elimination of the remaining bromine atom and successfully forging the carbon-carbon triple bond. We have now formed 1-butyne.
The Final Calculation
Acidic Workup
Don't make a silly mistake and stop here! The alkyne we just formed is a terminal alkyne. The hydrogen atom attached to the sp-hybridized carbon is highly acidic. Because we are operating in a strongly basic medium (sodamide is still present), an acid-base reaction occurs instantaneously.
CH3CH2C≡CH+NaNH2→CH3CH2C≡C−Na++NH3
The strong base abstracts the acidic proton, leaving us with a sodium alkynide salt. To isolate our desired neutral alkyne, we must perform a mild acidic workup (adding H+) to re-protonate the alkynide ion.
CH3CH2C≡C−Na+H+CH3CH2C≡CH
And there we have it! The final major product is 1-butyne, making option (d) the correct answer. Always remember to respect the strength of your bases and the acidity of your products!